C44H55FN4O8 — CID 150906341
ethyl 1-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-6-fluoro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 150906341) has the molecular formula C44H55FN4O8 and a molecular weight of 786.94 g/mol. Its IUPAC name is ethyl 1-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-6-fluoro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | ethyl 1-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-6-fluoro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 150906341 |
| Molecular Formula | C44H55FN4O8 |
| Molecular Weight | 786.94 g/mol |
| Exact Mass | 786.40 |
| IUPAC Name | ethyl 1-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-6-fluoro-7-[3-(hydroxymethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2ccc(F)c(-c3c(CO)nn(C)c3C)c2n1CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H55FN4O8/c1-10-54-40(51)39-31(20-16-26-55-35-21-15-18-29-17-11-12-19-30(29)35)32-22-23-33(45)37(36-28(2)47(9)46-34(36)27-50)38(32)48(39)24-13-14-25-49(41(52)56-43(3,4)5)42(53)57-44(6,7)8/h11-12,15,17-19,21-23,50H,10,13-14,16,20,24-27H2,1-9H3 |
| InChIKey | LBBCYTCUGJFMRC-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.94 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|