C39H47BrN4O5 — CID 175168250
7-[3-(bromomethyl)-5-ethyl-1-methylpyrazol-4-yl]-6-methyl-1-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid (PubChem CID 175168250) has the molecular formula C39H47BrN4O5 and a molecular weight of 731.73 g/mol. Its IUPAC name is 7-[3-(bromomethyl)-5-ethyl-1-methylpyrazol-4-yl]-6-methyl-1-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid.
| Compound Name | 7-[3-(bromomethyl)-5-ethyl-1-methylpyrazol-4-yl]-6-methyl-1-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175168250 |
| Molecular Formula | C39H47BrN4O5 |
| Molecular Weight | 731.73 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | 7-[3-(bromomethyl)-5-ethyl-1-methylpyrazol-4-yl]-6-methyl-1-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| SMILES | CCc1c(-c2c(C)ccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)n(CCCN(C)C(=O)OC(C)(C)C)c23)c(CBr)nn1C |
| InChI | InChI=1S/C39H47BrN4O5/c1-8-31-34(30(24-40)41-43(31)7)33-25(2)19-20-29-28(17-12-23-48-32-18-11-15-26-14-9-10-16-27(26)32)36(37(45)46)44(35(29)33)22-13-21-42(6)38(47)49-39(3,4)5/h9-11,14-16,18-20H,8,12-13,17,21-24H2,1-7H3,(H,45,46) |
| InChIKey | MKUKICHDXARMIJ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.73 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|