C39H47BrN4O6 — CID 175174196
7-[5-(bromomethyl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-1-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid (PubChem CID 175174196) has the molecular formula C39H47BrN4O6 and a molecular weight of 747.73 g/mol. Its IUPAC name is 7-[5-(bromomethyl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-1-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid.
| Compound Name | 7-[5-(bromomethyl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-1-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175174196 |
| Molecular Formula | C39H47BrN4O6 |
| Molecular Weight | 747.73 g/mol |
| Exact Mass | 746.27 |
| IUPAC Name | 7-[5-(bromomethyl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-1-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| SMILES | COCc1nn(C)c(CBr)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n(CCCCN(C)C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C39H47BrN4O6/c1-39(2,3)50-38(47)42(4)21-9-10-22-44-35-28(17-12-18-30(35)34-31(25-48-6)41-43(5)32(34)24-40)29(36(44)37(45)46)19-13-23-49-33-20-11-15-26-14-7-8-16-27(26)33/h7-8,11-12,14-18,20H,9-10,13,19,21-25H2,1-6H3,(H,45,46) |
| InChIKey | VGQAGKMNERPACJ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.73 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|