C45H63N5O4Si — CID 174027816
tert-butyl 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 174027816) has the molecular formula C45H63N5O4Si and a molecular weight of 766.12 g/mol. Its IUPAC name is tert-butyl 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | tert-butyl 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 174027816 |
| Molecular Formula | C45H63N5O4Si |
| Molecular Weight | 766.12 g/mol |
| Exact Mass | 765.46 |
| IUPAC Name | tert-butyl 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,5-dimethylpyrazol-4-yl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)OC(C)(C)C)n(CCN4CCN(C)CC4)c23)c(CO[Si](C)(C)C(C)(C)C)nn1C |
| InChI | InChI=1S/C45H63N5O4Si/c1-32-40(38(46-48(32)9)31-53-55(10,11)45(5,6)7)37-21-15-20-35-36(22-16-30-52-39-23-14-18-33-17-12-13-19-34(33)39)42(43(51)54-44(2,3)4)50(41(35)37)29-28-49-26-24-47(8)25-27-49/h12-15,17-21,23H,16,22,24-31H2,1-11H3 |
| InChIKey | LKKMGDBWTQKRFU-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 73.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.12 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|