C42H44BN5O4 — CID 166152350
CID 166152350 (PubChem CID 166152350) has the molecular formula C42H44BN5O4 and a molecular weight of 693.66 g/mol.
| Compound Name | CID 166152350 |
|---|---|
| PubChem CID | 166152350 |
| Molecular Formula | C42H44BN5O4 |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 693.35 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OCc2nn(C)c(C)c2-c2cccc3c(CCCOc4cccc5ccccc45)c(C=O)n(CCN4CCN(C)CC4)c23)cc1C=O |
| InChI | InChI=1S/C42H44BN5O4/c1-29-41(38(44-46(29)3)28-52-32-16-17-37(43)31(25-32)26-49)36-13-7-12-35-34(14-8-24-51-40-15-6-10-30-9-4-5-11-33(30)40)39(27-50)48(42(35)36)23-22-47-20-18-45(2)19-21-47/h4-7,9-13,15-17,25-27H,8,14,18-24,28H2,1-3H3 |
| InChIKey | UMKNNFPUURSAQL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 81.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|