C40H52BrN5O4 — CID 167669183
ethyl 7-[3-(bromomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;methane (PubChem CID 167669183) has the molecular formula C40H52BrN5O4 and a molecular weight of 746.79 g/mol. Its IUPAC name is ethyl 7-[3-(bromomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;methane.
| Compound Name | ethyl 7-[3-(bromomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;methane |
|---|---|
| PubChem CID | 167669183 |
| Molecular Formula | C40H52BrN5O4 |
| Molecular Weight | 746.79 g/mol |
| Exact Mass | 745.32 |
| IUPAC Name | ethyl 7-[3-(bromomethyl)-5-methyl-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1-[3-(methylamino)propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;methane |
| SMILES | C.CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2cccc(-c3c(CBr)nn(CCN4CCOCC4)c3C)c2n1CCCNC |
| InChI | InChI=1S/C39H48BrN5O4.CH4/c1-4-48-39(46)38-32(16-9-24-49-35-17-7-12-29-11-5-6-13-30(29)35)31-14-8-15-33(37(31)44(38)19-10-18-41-3)36-28(2)45(42-34(36)27-40)21-20-43-22-25-47-26-23-43;/h5-8,11-15,17,41H,4,9-10,16,18-27H2,1-3H3;1H4 |
| InChIKey | TVUAMIGJRZZMIR-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|