C38H40BrClN4O3 — CID 162460491
ethyl 1-[[2-(aminomethyl)phenyl]methyl]-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;hydrochloride (PubChem CID 162460491) has the molecular formula C38H40BrClN4O3 and a molecular weight of 716.12 g/mol. Its IUPAC name is ethyl 1-[[2-(aminomethyl)phenyl]methyl]-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[[2-(aminomethyl)phenyl]methyl]-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 162460491 |
| Molecular Formula | C38H40BrClN4O3 |
| Molecular Weight | 716.12 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | ethyl 1-[[2-(aminomethyl)phenyl]methyl]-7-[3-(bromomethyl)-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2cccc(-c3c(CBr)nn(C)c3C)c2n1Cc1ccccc1CN.Cl |
| InChI | InChI=1S/C38H39BrN4O3.ClH/c1-4-45-38(44)37-31(19-11-21-46-34-20-9-15-26-12-7-8-16-29(26)34)30-17-10-18-32(35-25(2)42(3)41-33(35)22-39)36(30)43(37)24-28-14-6-5-13-27(28)23-40;/h5-10,12-18,20H,4,11,19,21-24,40H2,1-3H3;1H |
| InChIKey | FCHXSZPDQQUDLB-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.12 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|