C34H32N4O3 — CID 25144617
3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid (PubChem CID 25144617) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid.
| Compound Name | 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25144617 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid |
| SMILES | Cc1nn(C)c(C)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n(Cc3cccnc3)c12 |
| InChI | InChI=1S/C34H32N4O3/c1-22-31(23(2)37(3)36-22)29-15-7-14-27-28(16-9-19-41-30-17-6-12-25-11-4-5-13-26(25)30)33(34(39)40)38(32(27)29)21-24-10-8-18-35-20-24/h4-8,10-15,17-18,20H,9,16,19,21H2,1-3H3,(H,39,40) |
| InChIKey | YMZQNNNCZKIMOW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|