C43H44Cl2N6O4 — CID 137376172
3-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid (PubChem CID 137376172) has the molecular formula C43H44Cl2N6O4 and a molecular weight of 779.77 g/mol. Its IUPAC name is 3-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid.
| Compound Name | 3-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 137376172 |
| Molecular Formula | C43H44Cl2N6O4 |
| Molecular Weight | 779.77 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | 3-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)N3CCN(c4cccc(C(=O)O)c4)CC3)n(Cc3cccnc3)c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C43H44Cl2N6O4/c1-26-21-33(22-27(2)39(26)45)55-20-8-12-34-35-13-14-36(44)38(37-28(3)47-48(5)29(37)4)40(35)51(25-30-9-7-15-46-24-30)41(34)42(52)50-18-16-49(17-19-50)32-11-6-10-31(23-32)43(53)54/h6-7,9-11,13-15,21-24H,8,12,16-20,25H2,1-5H3,(H,53,54) |
| InChIKey | IWOACSGFFNVNOU-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|