C28H31Cl2N3O3 — CID 166152696
methyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate (PubChem CID 166152696) has the molecular formula C28H31Cl2N3O3 and a molecular weight of 528.48 g/mol. Its IUPAC name is methyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate.
| Compound Name | methyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 166152696 |
| Molecular Formula | C28H31Cl2N3O3 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | methyl 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylate |
| SMILES | COC(=O)c1c(CCCOc2cc(C)c(Cl)c(C)c2)c2ccc(Cl)c(-c3c(C)nn(C)c3C)c2n1C |
| InChI | InChI=1S/C28H31Cl2N3O3/c1-15-13-19(14-16(2)25(15)30)36-12-8-9-20-21-10-11-22(29)24(23-17(3)31-33(6)18(23)4)26(21)32(5)27(20)28(34)35-7/h10-11,13-14H,8-9,12H2,1-7H3 |
| InChIKey | NRIRCLTYXLKARV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|