C35H36Cl2N4O4 — CID 118394947
methyl 3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-5-methylbenzoate (PubChem CID 118394947) has the molecular formula C35H36Cl2N4O4 and a molecular weight of 647.60 g/mol. Its IUPAC name is methyl 3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-5-methylbenzoate.
| Compound Name | methyl 3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 118394947 |
| Molecular Formula | C35H36Cl2N4O4 |
| Molecular Weight | 647.60 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | methyl 3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)cc(NC(=O)c2[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc3c2CCCOc2cc(C)c(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C35H36Cl2N4O4/c1-18-13-23(35(43)44-7)17-24(14-18)38-34(42)33-26(9-8-12-45-25-15-19(2)31(37)20(3)16-25)27-10-11-28(36)30(32(27)39-33)29-21(4)40-41(6)22(29)5/h10-11,13-17,39H,8-9,12H2,1-7H3,(H,38,42) |
| InChIKey | TUGRWLRIMQUVPG-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.60 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|