C34H35ClN4O4 — CID 118394987
2-[3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]phenyl]acetic acid (PubChem CID 118394987) has the molecular formula C34H35ClN4O4 and a molecular weight of 599.13 g/mol. Its IUPAC name is 2-[3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 118394987 |
| Molecular Formula | C34H35ClN4O4 |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 2-[3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]phenyl]acetic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)Nc3cccc(CC(=O)O)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H35ClN4O4/c1-19-15-25(16-20(2)31(19)35)43-14-8-13-27-26-11-7-12-28(30-21(3)38-39(5)22(30)4)32(26)37-33(27)34(42)36-24-10-6-9-23(17-24)18-29(40)41/h6-7,9-12,15-17,37H,8,13-14,18H2,1-5H3,(H,36,42)(H,40,41) |
| InChIKey | LWMIXKRQYJFKBN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|