C34H34ClF3N4O3 — CID 118407058
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide (PubChem CID 118407058) has the molecular formula C34H34ClF3N4O3 and a molecular weight of 639.12 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118407058 |
| Molecular Formula | C34H34ClF3N4O3 |
| Molecular Weight | 639.12 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCc3cccc(OC(F)(F)F)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H34ClF3N4O3/c1-19-15-25(16-20(2)30(19)35)44-14-8-13-27-26-11-7-12-28(29-21(3)41-42(5)22(29)4)31(26)40-32(27)33(43)39-18-23-9-6-10-24(17-23)45-34(36,37)38/h6-7,9-12,15-17,40H,8,13-14,18H2,1-5H3,(H,39,43) |
| InChIKey | LJRVNJKQIDRIGQ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.12 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|