C33H34Cl2N4O2 — CID 147040897
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(2-chloro-4-pyridinyl)methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide (PubChem CID 147040897) has the molecular formula C33H34Cl2N4O2 and a molecular weight of 589.57 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(2-chloro-4-pyridinyl)methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(2-chloro-4-pyridinyl)methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 147040897 |
| Molecular Formula | C33H34Cl2N4O2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(2-chloro-4-pyridinyl)methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
| SMILES | Cc1cc(OCCCC2=C(C(=O)NCc3ccnc(Cl)c3)Cc3c2cccc3-c2c(C)nn(C)c2C)cc(C)c1Cl |
| InChI | InChI=1S/C33H34Cl2N4O2/c1-19-14-24(15-20(2)32(19)35)41-13-7-10-26-25-8-6-9-27(31-21(3)38-39(5)22(31)4)28(25)17-29(26)33(40)37-18-23-11-12-36-30(34)16-23/h6,8-9,11-12,14-16H,7,10,13,17-18H2,1-5H3,(H,37,40) |
| InChIKey | AZKVRIKAMCUBEB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|