C34H37ClN4O3 — CID 163781601
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-(1-hydroxyethenyl)-1H-pyrrol-3-yl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide (PubChem CID 163781601) has the molecular formula C34H37ClN4O3 and a molecular weight of 585.15 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-(1-hydroxyethenyl)-1H-pyrrol-3-yl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-(1-hydroxyethenyl)-1H-pyrrol-3-yl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 163781601 |
| Molecular Formula | C34H37ClN4O3 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-(1-hydroxyethenyl)-1H-pyrrol-3-yl]methyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
| SMILES | C=C(O)c1cc(CNC(=O)C2=C(CCCOc3cc(C)c(Cl)c(C)c3)c3cccc(-c4c(C)nn(C)c4C)c3C2)c[nH]1 |
| InChI | InChI=1S/C34H37ClN4O3/c1-19-13-25(14-20(2)33(19)35)42-12-8-11-27-26-9-7-10-28(32-21(3)38-39(6)22(32)4)29(26)16-30(27)34(41)37-18-24-15-31(23(5)40)36-17-24/h7,9-10,13-15,17,36,40H,5,8,11-12,16,18H2,1-4,6H3,(H,37,41) |
| InChIKey | ANSMVQDBCJPYFT-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|