C35H38ClN3O2 — CID 163998396
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-ethylphenyl)-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide (PubChem CID 163998396) has the molecular formula C35H38ClN3O2 and a molecular weight of 568.16 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-ethylphenyl)-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-ethylphenyl)-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 163998396 |
| Molecular Formula | C35H38ClN3O2 |
| Molecular Weight | 568.16 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-ethylphenyl)-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indene-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2=C(CCCOc3cc(C)c(Cl)c(C)c3)c3cccc(-c4c(C)nn(C)c4C)c3C2)cc1 |
| InChI | InChI=1S/C35H38ClN3O2/c1-7-25-13-15-26(16-14-25)37-35(40)32-20-31-28(10-8-11-30(31)33-23(4)38-39(6)24(33)5)29(32)12-9-17-41-27-18-21(2)34(36)22(3)19-27/h8,10-11,13-16,18-19H,7,9,12,17,20H2,1-6H3,(H,37,40) |
| InChIKey | DAHPTDWVEPNGSY-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.16 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|