C34H33BrCl2N4O4 — CID 118394887
3-bromo-5-[[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]benzoic acid (PubChem CID 118394887) has the molecular formula C34H33BrCl2N4O4 and a molecular weight of 712.47 g/mol. Its IUPAC name is 3-bromo-5-[[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 3-bromo-5-[[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 118394887 |
| Molecular Formula | C34H33BrCl2N4O4 |
| Molecular Weight | 712.47 g/mol |
| Exact Mass | 710.11 |
| IUPAC Name | 3-bromo-5-[[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]benzoic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCc3cc(Br)cc(C(=O)O)c3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H33BrCl2N4O4/c1-17-11-24(12-18(2)30(17)37)45-10-6-7-25-26-8-9-27(36)29(28-19(3)40-41(5)20(28)4)31(26)39-32(25)33(42)38-16-21-13-22(34(43)44)15-23(35)14-21/h8-9,11-15,39H,6-7,10,16H2,1-5H3,(H,38,42)(H,43,44) |
| InChIKey | FJAQFLRYNRBVAY-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.47 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|