C32H37Cl2N5O5 — CID 144935090
6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(3S)-1-(2,2-dihydroxyacetyl)pyrrolidin-3-yl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide (PubChem CID 144935090) has the molecular formula C32H37Cl2N5O5 and a molecular weight of 642.58 g/mol. Its IUPAC name is 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(3S)-1-(2,2-dihydroxyacetyl)pyrrolidin-3-yl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(3S)-1-(2,2-dihydroxyacetyl)pyrrolidin-3-yl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144935090 |
| Molecular Formula | C32H37Cl2N5O5 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[(3S)-1-(2,2-dihydroxyacetyl)pyrrolidin-3-yl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)N[C@H]3CCN(C(=O)C(O)O)C3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C32H37Cl2N5O5/c1-16-13-21(14-17(2)27(16)34)44-12-6-7-22-23-8-9-24(33)26(25-18(3)37-38(5)19(25)4)28(23)36-29(22)30(40)35-20-10-11-39(15-20)31(41)32(42)43/h8-9,13-14,20,32,36,42-43H,6-7,10-12,15H2,1-5H3,(H,35,40)/t20-/m0/s1 |
| InChIKey | GZHLUYYMVRDCIY-FQEVSTJZSA-N |
| XLogP | 4.76 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|