C33H37Cl2N5O5 — CID 118394720
2-[3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]piperidin-1-yl]-2-oxoacetic acid (PubChem CID 118394720) has the molecular formula C33H37Cl2N5O5 and a molecular weight of 654.60 g/mol. Its IUPAC name is 2-[3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]piperidin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]piperidin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 118394720 |
| Molecular Formula | C33H37Cl2N5O5 |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | 2-[3-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]piperidin-1-yl]-2-oxoacetic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)NC3CCCN(C(=O)C(=O)O)C3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C33H37Cl2N5O5/c1-17-14-22(15-18(2)28(17)35)45-13-7-9-23-24-10-11-25(34)27(26-19(3)38-39(5)20(26)4)29(24)37-30(23)31(41)36-21-8-6-12-40(16-21)32(42)33(43)44/h10-11,14-15,21,37H,6-9,12-13,16H2,1-5H3,(H,36,41)(H,43,44) |
| InChIKey | VEIQBRJMJBXJLZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|