C30H35ClN4O3 — CID 118394687
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[1,5-dimethyl-3-(pyrrolidin-1-ylmethyl)pyrazol-4-yl]-1H-indole-2-carboxylic acid (PubChem CID 118394687) has the molecular formula C30H35ClN4O3 and a molecular weight of 535.09 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[1,5-dimethyl-3-(pyrrolidin-1-ylmethyl)pyrazol-4-yl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[1,5-dimethyl-3-(pyrrolidin-1-ylmethyl)pyrazol-4-yl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118394687 |
| Molecular Formula | C30H35ClN4O3 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[1,5-dimethyl-3-(pyrrolidin-1-ylmethyl)pyrazol-4-yl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)[nH]c3c(-c4c(CN5CCCC5)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C30H35ClN4O3/c1-18-15-21(16-19(2)27(18)31)38-14-8-11-23-22-9-7-10-24(28(22)32-29(23)30(36)37)26-20(3)34(4)33-25(26)17-35-12-5-6-13-35/h7,9-10,15-16,32H,5-6,8,11-14,17H2,1-4H3,(H,36,37) |
| InChIKey | USDNDYSOMSWDIH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|