C33H42ClN5O3 — CID 167247619
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid (PubChem CID 167247619) has the molecular formula C33H42ClN5O3 and a molecular weight of 592.18 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 167247619 |
| Molecular Formula | C33H42ClN5O3 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-[2-(4-methylpiperazin-1-yl)ethyl]-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n(CCN3CCN(C)CC3)c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C33H42ClN5O3/c1-21-19-25(20-22(2)30(21)34)42-18-8-11-27-26-9-7-10-28(29-23(3)35-37(6)24(29)4)31(26)39(32(27)33(40)41)17-16-38-14-12-36(5)13-15-38/h7,9-10,19-20H,8,11-18H2,1-6H3,(H,40,41) |
| InChIKey | VIPJKQCQOUSXLV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|