C34H38ClN5O2S — CID 144800762
3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-4-ylsulfanylpropanamide (PubChem CID 144800762) has the molecular formula C34H38ClN5O2S and a molecular weight of 616.23 g/mol. Its IUPAC name is 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-4-ylsulfanylpropanamide.
| Compound Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-4-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 144800762 |
| Molecular Formula | C34H38ClN5O2S |
| Molecular Weight | 616.23 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-4-ylsulfanylpropanamide |
| SMILES | Cc1cc(OCCCc2c(C)n(CCC(=O)NSc3ccncc3)c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H38ClN5O2S/c1-21-19-26(20-22(2)33(21)35)42-18-8-11-28-24(4)40(17-14-31(41)38-43-27-12-15-36-16-13-27)34-29(28)9-7-10-30(34)32-23(3)37-39(6)25(32)5/h7,9-10,12-13,15-16,19-20H,8,11,14,17-18H2,1-6H3,(H,38,41) |
| InChIKey | VWYMZCLMQIYVMR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.23 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|