C34H37ClN4O3S — CID 144593342
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-methyl-N-phenylsulfanylindole-2-carboxamide (PubChem CID 144593342) has the molecular formula C34H37ClN4O3S and a molecular weight of 617.22 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-methyl-N-phenylsulfanylindole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-methyl-N-phenylsulfanylindole-2-carboxamide |
|---|---|
| PubChem CID | 144593342 |
| Molecular Formula | C34H37ClN4O3S |
| Molecular Weight | 617.22 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-methyl-N-phenylsulfanylindole-2-carboxamide |
| SMILES | COCc1nn(C)c(C)c1-c1cccc2c(CCCOc3cc(C)c(Cl)c(C)c3)c(C(=O)NSc3ccccc3)n(C)c12 |
| InChI | InChI=1S/C34H37ClN4O3S/c1-21-18-24(19-22(2)31(21)35)42-17-11-16-27-26-14-10-15-28(30-23(3)39(5)36-29(30)20-41-6)32(26)38(4)33(27)34(40)37-43-25-12-8-7-9-13-25/h7-10,12-15,18-19H,11,16-17,20H2,1-6H3,(H,37,40) |
| InChIKey | LTGCIQZZHBXMOS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.22 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|