C30H27ClN2O2S2 — CID 144593273
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-phenylsulfanyl-7-thiophen-3-yl-1H-indole-2-carboxamide (PubChem CID 144593273) has the molecular formula C30H27ClN2O2S2 and a molecular weight of 547.15 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-phenylsulfanyl-7-thiophen-3-yl-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-phenylsulfanyl-7-thiophen-3-yl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144593273 |
| Molecular Formula | C30H27ClN2O2S2 |
| Molecular Weight | 547.15 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-phenylsulfanyl-7-thiophen-3-yl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NSc3ccccc3)[nH]c3c(-c4ccsc4)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C30H27ClN2O2S2/c1-19-16-22(17-20(2)27(19)31)35-14-7-12-26-25-11-6-10-24(21-13-15-36-18-21)28(25)32-29(26)30(34)33-37-23-8-4-3-5-9-23/h3-6,8-11,13,15-18,32H,7,12,14H2,1-2H3,(H,33,34) |
| InChIKey | FMDWSJRARBYKHW-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.15 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|