C28H30ClN2O4S+ — CID 144593250
CID 144593250 (PubChem CID 144593250) has the molecular formula C28H30ClN2O4S+ and a molecular weight of 526.08 g/mol.
| Compound Name | CID 144593250 |
|---|---|
| PubChem CID | 144593250 |
| Molecular Formula | C28H30ClN2O4S+ |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1-c1cccc2c(CCCOc3cc(C)c(Cl)c(C)c3)c(C(=O)N[S+](C)(=O)O)[nH]c12 |
| InChI | InChI=1S/C28H29ClN2O4S/c1-17-9-5-6-10-21(17)22-11-7-12-23-24(27(30-26(22)23)28(32)31-36(4,33)34)13-8-14-35-20-15-18(2)25(29)19(3)16-20/h5-7,9-12,15-16H,8,13-14H2,1-4H3,(H2-,30,31,32,33,34)/p+1 |
| InChIKey | IIOKVMVBSJVZLK-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|