C30H27ClN2O3S — CID 144593321
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-naphthalen-1-ylsulfinyl-1H-indole-2-carboxamide (PubChem CID 144593321) has the molecular formula C30H27ClN2O3S and a molecular weight of 531.08 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-naphthalen-1-ylsulfinyl-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-naphthalen-1-ylsulfinyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144593321 |
| Molecular Formula | C30H27ClN2O3S |
| Molecular Weight | 531.08 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-naphthalen-1-ylsulfinyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)c3cccc4ccccc34)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C30H27ClN2O3S/c1-19-17-22(18-20(2)28(19)31)36-16-8-13-25-24-12-5-6-14-26(24)32-29(25)30(34)33-37(35)27-15-7-10-21-9-3-4-11-23(21)27/h3-7,9-12,14-15,17-18,32H,8,13,16H2,1-2H3,(H,33,34) |
| InChIKey | TUCOFKLMQRDSIG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.08 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|