C32H33ClN4O5S — CID 90082781
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90082781) has the molecular formula C32H33ClN4O5S and a molecular weight of 621.16 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90082781 |
| Molecular Formula | C32H33ClN4O5S |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)Cc3c[nH]c4ccccc34)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C32H33ClN4O5S/c1-20-16-23(17-21(2)30(20)33)42-14-7-10-26-25-9-4-6-12-28(25)36-31(26)32(39)37-43(40,41)15-13-34-29(38)18-22-19-35-27-11-5-3-8-24(22)27/h3-6,8-9,11-12,16-17,19,35-36H,7,10,13-15,18H2,1-2H3,(H,34,38)(H,37,39) |
| InChIKey | ADAUAVYLNNVRIR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|