C31H33Cl2N3O5S — CID 118521920
6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(3-phenylpropanoylamino)ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 118521920) has the molecular formula C31H33Cl2N3O5S and a molecular weight of 630.59 g/mol. Its IUPAC name is 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(3-phenylpropanoylamino)ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(3-phenylpropanoylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118521920 |
| Molecular Formula | C31H33Cl2N3O5S |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(3-phenylpropanoylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)CCc3ccccc3)[nH]c3cc(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C31H33Cl2N3O5S/c1-20-17-24(18-21(2)29(20)33)41-15-6-9-26-25-12-11-23(32)19-27(25)35-30(26)31(38)36-42(39,40)16-14-34-28(37)13-10-22-7-4-3-5-8-22/h3-5,7-8,11-12,17-19,35H,6,9-10,13-16H2,1-2H3,(H,34,37)(H,36,38) |
| InChIKey | GOAOGYSPZBPJQF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|