C28H29ClN2O5S — CID 90080930
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(2-phenoxyethylsulfonyl)-1H-indole-2-carboxamide (PubChem CID 90080930) has the molecular formula C28H29ClN2O5S and a molecular weight of 541.07 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(2-phenoxyethylsulfonyl)-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(2-phenoxyethylsulfonyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90080930 |
| Molecular Formula | C28H29ClN2O5S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(2-phenoxyethylsulfonyl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCOc3ccccc3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C28H29ClN2O5S/c1-19-17-22(18-20(2)26(19)29)35-14-8-12-24-23-11-6-7-13-25(23)30-27(24)28(32)31-37(33,34)16-15-36-21-9-4-3-5-10-21/h3-7,9-11,13,17-18,30H,8,12,14-16H2,1-2H3,(H,31,32) |
| InChIKey | RJSZFIHODLTGBK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|