C25H24N2O5S — CID 90083863
N-methylsulfonyl-3-[3-(3-phenoxyphenoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 90083863) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is N-methylsulfonyl-3-[3-(3-phenoxyphenoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | N-methylsulfonyl-3-[3-(3-phenoxyphenoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90083863 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-methylsulfonyl-3-[3-(3-phenoxyphenoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1[nH]c2ccccc2c1CCCOc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O5S/c1-33(29,30)27-25(28)24-22(21-13-5-6-15-23(21)26-24)14-8-16-31-19-11-7-12-20(17-19)32-18-9-3-2-4-10-18/h2-7,9-13,15,17,26H,8,14,16H2,1H3,(H,27,28) |
| InChIKey | UPODZIPJMFUUFT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|