C28H30ClN3O6S — CID 90085780
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(3-methylfuran-2-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90085780) has the molecular formula C28H30ClN3O6S and a molecular weight of 572.08 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(3-methylfuran-2-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(3-methylfuran-2-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90085780 |
| Molecular Formula | C28H30ClN3O6S |
| Molecular Weight | 572.08 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-[(3-methylfuran-2-carbonyl)amino]ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCCS(=O)(=O)NC(=O)c1[nH]c2ccccc2c1CCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C28H30ClN3O6S/c1-17-10-13-38-26(17)28(34)30-11-14-39(35,36)32-27(33)25-22(21-7-4-5-9-23(21)31-25)8-6-12-37-20-15-18(2)24(29)19(3)16-20/h4-5,7,9-10,13,15-16,31H,6,8,11-12,14H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | ZCLURQLJKKPDQQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|