C29H37ClN4O5S — CID 90082783
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexylcarbamoylamino)ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90082783) has the molecular formula C29H37ClN4O5S and a molecular weight of 589.16 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexylcarbamoylamino)ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexylcarbamoylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90082783 |
| Molecular Formula | C29H37ClN4O5S |
| Molecular Weight | 589.16 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexylcarbamoylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)NC3CCCCC3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C29H37ClN4O5S/c1-19-17-22(18-20(2)26(19)30)39-15-8-12-24-23-11-6-7-13-25(23)33-27(24)28(35)34-40(37,38)16-14-31-29(36)32-21-9-4-3-5-10-21/h6-7,11,13,17-18,21,33H,3-5,8-10,12,14-16H2,1-2H3,(H,34,35)(H2,31,32,36) |
| InChIKey | VXQKGHVJAJGDHP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|