C29H35Cl2N3O5S — CID 90083842
4-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexanecarbonylamino)ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90083842) has the molecular formula C29H35Cl2N3O5S and a molecular weight of 608.59 g/mol. Its IUPAC name is 4-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexanecarbonylamino)ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexanecarbonylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90083842 |
| Molecular Formula | C29H35Cl2N3O5S |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 4-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(cyclohexanecarbonylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)C3CCCCC3)[nH]c3cccc(Cl)c23)cc(C)c1Cl |
| InChI | InChI=1S/C29H35Cl2N3O5S/c1-18-16-21(17-19(2)26(18)31)39-14-7-10-22-25-23(30)11-6-12-24(25)33-27(22)29(36)34-40(37,38)15-13-32-28(35)20-8-4-3-5-9-20/h6,11-12,16-17,20,33H,3-5,7-10,13-15H2,1-2H3,(H,32,35)(H,34,36) |
| InChIKey | ICBDWYFBGGTQQX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|