C20H20Cl2N2O4S — CID 90085641
4-chloro-3-[3-(4-chloro-3-methylphenoxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide (PubChem CID 90085641) has the molecular formula C20H20Cl2N2O4S and a molecular weight of 455.36 g/mol. Its IUPAC name is 4-chloro-3-[3-(4-chloro-3-methylphenoxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-3-[3-(4-chloro-3-methylphenoxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90085641 |
| Molecular Formula | C20H20Cl2N2O4S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 4-chloro-3-[3-(4-chloro-3-methylphenoxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(C)(=O)=O)[nH]c3cccc(Cl)c23)ccc1Cl |
| InChI | InChI=1S/C20H20Cl2N2O4S/c1-12-11-13(8-9-15(12)21)28-10-4-5-14-18-16(22)6-3-7-17(18)23-19(14)20(25)24-29(2,26)27/h3,6-9,11,23H,4-5,10H2,1-2H3,(H,24,25) |
| InChIKey | BMOUDEHLGASSSV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|