C21H22ClNO3 — CID 90083112
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-1H-indole-2-carboxylic acid (PubChem CID 90083112) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90083112 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-methyl-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)[nH]c3cccc(C)c23)cc(C)c1Cl |
| InChI | InChI=1S/C21H22ClNO3/c1-12-6-4-8-17-18(12)16(20(23-17)21(24)25)7-5-9-26-15-10-13(2)19(22)14(3)11-15/h4,6,8,10-11,23H,5,7,9H2,1-3H3,(H,24,25) |
| InChIKey | JWLKWXVWKZPSED-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|