C27H31ClF3N3O4 — CID 118394772
(4-aminopiperidin-1-yl)-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 118394772) has the molecular formula C27H31ClF3N3O4 and a molecular weight of 554.01 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-aminopiperidin-1-yl)-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118394772 |
| Molecular Formula | C27H31ClF3N3O4 |
| Molecular Weight | 554.01 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)N3CCC(N)CC3)[nH]c3ccccc23)cc(C)c1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H30ClN3O2.C2HF3O2/c1-16-14-19(15-17(2)23(16)26)31-13-5-7-21-20-6-3-4-8-22(20)28-24(21)25(30)29-11-9-18(27)10-12-29;3-2(4,5)1(6)7/h3-4,6,8,14-15,18,28H,5,7,9-13,27H2,1-2H3;(H,6,7) |
| InChIKey | RGSDBQDMHOKSIW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|