C34H31ClF3N3O4 — CID 118406989
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]furan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 118406989) has the molecular formula C34H31ClF3N3O4 and a molecular weight of 638.09 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]furan-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]furan-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118406989 |
| Molecular Formula | C34H31ClF3N3O4 |
| Molecular Weight | 638.09 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[[5-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]furan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCc3ccc(C(=O)NCc4ccccc4C(F)(F)F)o3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H31ClF3N3O4/c1-20-16-24(17-21(2)30(20)35)44-15-7-10-26-25-9-4-6-12-28(25)41-31(26)33(43)40-19-23-13-14-29(45-23)32(42)39-18-22-8-3-5-11-27(22)34(36,37)38/h3-6,8-9,11-14,16-17,41H,7,10,15,18-19H2,1-2H3,(H,39,42)(H,40,43) |
| InChIKey | XDLMZOBZZVSXNZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.09 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|