C31H30ClN3O4S — CID 144593258
N-[2-(1-benzofuran-2-carbonylamino)ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 144593258) has the molecular formula C31H30ClN3O4S and a molecular weight of 576.12 g/mol. Its IUPAC name is N-[2-(1-benzofuran-2-carbonylamino)ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(1-benzofuran-2-carbonylamino)ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144593258 |
| Molecular Formula | C31H30ClN3O4S |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | N-[2-(1-benzofuran-2-carbonylamino)ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NSCCNC(=O)c3cc4ccccc4o3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C31H30ClN3O4S/c1-19-16-22(17-20(2)28(19)32)38-14-7-10-24-23-9-4-5-11-25(23)34-29(24)31(37)35-40-15-13-33-30(36)27-18-21-8-3-6-12-26(21)39-27/h3-6,8-9,11-12,16-18,34H,7,10,13-15H2,1-2H3,(H,33,36)(H,35,37) |
| InChIKey | FYHPBXCQKBDKRQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|