C36H39ClN4O3S — CID 144593249
N-[2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 144593249) has the molecular formula C36H39ClN4O3S and a molecular weight of 643.25 g/mol. Its IUPAC name is N-[2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 144593249 |
| Molecular Formula | C36H39ClN4O3S |
| Molecular Weight | 643.25 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | N-[2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]ethylsulfanyl]-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NSCCNC(=O)c3cc(C)n(Cc4ccccc4)c3C)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C36H39ClN4O3S/c1-23-19-28(20-24(2)33(23)37)44-17-10-14-30-29-13-8-9-15-32(29)39-34(30)36(43)40-45-18-16-38-35(42)31-21-25(3)41(26(31)4)22-27-11-6-5-7-12-27/h5-9,11-13,15,19-21,39H,10,14,16-18,22H2,1-4H3,(H,38,42)(H,40,43) |
| InChIKey | XYMNXDLKOVHCMN-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.25 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|