C28H31ClN4O4S — CID 90083154
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(pyridin-4-ylmethylamino)ethylsulfonyl]-1H-indole-2-carboxamide (PubChem CID 90083154) has the molecular formula C28H31ClN4O4S and a molecular weight of 555.10 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(pyridin-4-ylmethylamino)ethylsulfonyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(pyridin-4-ylmethylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90083154 |
| Molecular Formula | C28H31ClN4O4S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[2-(pyridin-4-ylmethylamino)ethylsulfonyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNCc3ccncc3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C28H31ClN4O4S/c1-19-16-22(17-20(2)26(19)29)37-14-5-7-24-23-6-3-4-8-25(23)32-27(24)28(34)33-38(35,36)15-13-31-18-21-9-11-30-12-10-21/h3-4,6,8-12,16-17,31-32H,5,7,13-15,18H2,1-2H3,(H,33,34) |
| InChIKey | FPHYNQAQVZRCGP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|