C29H31ClN2O6S2 — CID 159580376
N-[2-[2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]benzenesulfonamide (PubChem CID 159580376) has the molecular formula C29H31ClN2O6S2 and a molecular weight of 603.16 g/mol. Its IUPAC name is N-[2-[2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 159580376 |
| Molecular Formula | C29H31ClN2O6S2 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | N-[2-[2-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]benzenesulfonamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)CS(=O)(=O)CCNS(=O)(=O)c3ccccc3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C29H31ClN2O6S2/c1-20-17-22(18-21(2)28(20)30)38-15-8-12-25-24-11-6-7-13-26(24)32-29(25)27(33)19-39(34,35)16-14-31-40(36,37)23-9-4-3-5-10-23/h3-7,9-11,13,17-18,31-32H,8,12,14-16,19H2,1-2H3 |
| InChIKey | MIYCCMSVMAPCHU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|