C36H37Cl2N3O5S — CID 159902230
N-[2-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]-1-[(2-methylphenyl)methyl]pyrrole-2-carboxamide (PubChem CID 159902230) has the molecular formula C36H37Cl2N3O5S and a molecular weight of 694.68 g/mol. Its IUPAC name is N-[2-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]-1-[(2-methylphenyl)methyl]pyrrole-2-carboxamide.
| Compound Name | N-[2-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]-1-[(2-methylphenyl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159902230 |
| Molecular Formula | C36H37Cl2N3O5S |
| Molecular Weight | 694.68 g/mol |
| Exact Mass | 693.18 |
| IUPAC Name | N-[2-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indol-2-yl]-2-oxoethyl]sulfonylethyl]-1-[(2-methylphenyl)methyl]pyrrole-2-carboxamide |
| SMILES | Cc1ccccc1Cn1cccc1C(=O)NCCS(=O)(=O)CC(=O)c1[nH]c2cc(Cl)ccc2c1CCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C36H37Cl2N3O5S/c1-23-8-4-5-9-26(23)21-41-15-6-11-32(41)36(43)39-14-17-47(44,45)22-33(42)35-30(29-13-12-27(37)20-31(29)40-35)10-7-16-46-28-18-24(2)34(38)25(3)19-28/h4-6,8-9,11-13,15,18-20,40H,7,10,14,16-17,21-22H2,1-3H3,(H,39,43) |
| InChIKey | NWCMPDGDHQQMSD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.68 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|