C40H39Cl2N5O5S — CID 118522027
N-[2-[(1-benzylpyrrole-2-carbonyl)amino]ethylsulfonyl]-6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)indole-2-carboxamide (PubChem CID 118522027) has the molecular formula C40H39Cl2N5O5S and a molecular weight of 772.76 g/mol. Its IUPAC name is N-[2-[(1-benzylpyrrole-2-carbonyl)amino]ethylsulfonyl]-6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)indole-2-carboxamide.
| Compound Name | N-[2-[(1-benzylpyrrole-2-carbonyl)amino]ethylsulfonyl]-6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 118522027 |
| Molecular Formula | C40H39Cl2N5O5S |
| Molecular Weight | 772.76 g/mol |
| Exact Mass | 771.20 |
| IUPAC Name | N-[2-[(1-benzylpyrrole-2-carbonyl)amino]ethylsulfonyl]-6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1-(pyridin-3-ylmethyl)indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCNC(=O)c3cccn3Cc3ccccc3)n(Cc3cccnc3)c3cc(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C40H39Cl2N5O5S/c1-27-21-32(22-28(2)37(27)42)52-19-8-12-34-33-15-14-31(41)23-36(33)47(26-30-11-6-16-43-24-30)38(34)40(49)45-53(50,51)20-17-44-39(48)35-13-7-18-46(35)25-29-9-4-3-5-10-29/h3-7,9-11,13-16,18,21-24H,8,12,17,19-20,25-26H2,1-2H3,(H,44,48)(H,45,49) |
| InChIKey | YBERWCFIUWXKKZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.76 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|