C24H30ClN3O5S — CID 123256933
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[3-hydroxy-3-(methanesulfonamido)propyl]-1H-indole-2-carboxamide (PubChem CID 123256933) has the molecular formula C24H30ClN3O5S and a molecular weight of 508.04 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[3-hydroxy-3-(methanesulfonamido)propyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[3-hydroxy-3-(methanesulfonamido)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 123256933 |
| Molecular Formula | C24H30ClN3O5S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-[3-hydroxy-3-(methanesulfonamido)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCCC(O)NS(C)(=O)=O)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C24H30ClN3O5S/c1-15-13-17(14-16(2)22(15)25)33-12-6-8-19-18-7-4-5-9-20(18)27-23(19)24(30)26-11-10-21(29)28-34(3,31)32/h4-5,7,9,13-14,21,27-29H,6,8,10-12H2,1-3H3,(H,26,30) |
| InChIKey | JGQACNKHZNOTPC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|