C22H25ClN2O4S — CID 123916303
5-chloro-N-methylsulfonyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 123916303) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is 5-chloro-N-methylsulfonyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-methylsulfonyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 123916303 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 5-chloro-N-methylsulfonyl-3-[3-(3,4,5-trimethylphenoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(C)(=O)=O)[nH]c3ccc(Cl)cc23)cc(C)c1C |
| InChI | InChI=1S/C22H25ClN2O4S/c1-13-10-17(11-14(2)15(13)3)29-9-5-6-18-19-12-16(23)7-8-20(19)24-21(18)22(26)25-30(4,27)28/h7-8,10-12,24H,5-6,9H2,1-4H3,(H,25,26) |
| InChIKey | JWZJLPXBENKXOJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|