C32H33ClN4O5 — CID 118394807
5-[[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 118394807) has the molecular formula C32H33ClN4O5 and a molecular weight of 589.09 g/mol. Its IUPAC name is 5-[[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 118394807 |
| Molecular Formula | C32H33ClN4O5 |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 5-[[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCc3ccc(C(=O)O)o3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C32H33ClN4O5/c1-17-14-22(15-18(2)28(17)33)41-13-7-10-24-23-8-6-9-25(27-19(3)36-37(5)20(27)4)29(23)35-30(24)31(38)34-16-21-11-12-26(42-21)32(39)40/h6,8-9,11-12,14-15,35H,7,10,13,16H2,1-5H3,(H,34,38)(H,39,40) |
| InChIKey | ZJAHIUIZCYFUIR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|