C33H37ClN4O5 — CID 155249817
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[[5-[ethoxy(hydroxy)methyl]furan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 155249817) has the molecular formula C33H37ClN4O5 and a molecular weight of 605.14 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[[5-[ethoxy(hydroxy)methyl]furan-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[[5-[ethoxy(hydroxy)methyl]furan-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155249817 |
| Molecular Formula | C33H37ClN4O5 |
| Molecular Weight | 605.14 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[[5-[ethoxy(hydroxy)methyl]furan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | CCOC(O)c1ccc(CNC(=O)c2[nH]c3c(-c4c(C)n[nH]c4C)cccc3c2CCCOc2cc(C)c(Cl)c(C)c2)o1 |
| InChI | InChI=1S/C33H37ClN4O5/c1-6-41-33(40)27-13-12-22(43-27)17-35-32(39)31-25(11-8-14-42-23-15-18(2)29(34)19(3)16-23)24-9-7-10-26(30(24)36-31)28-20(4)37-38-21(28)5/h7,9-10,12-13,15-16,33,36,40H,6,8,11,14,17H2,1-5H3,(H,35,39)(H,37,38) |
| InChIKey | STMJBHBLPYNHAA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.14 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|