C29H34ClN5O6S — CID 175590098
2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]sulfamoyl]ethyl carbamate (PubChem CID 175590098) has the molecular formula C29H34ClN5O6S and a molecular weight of 616.14 g/mol. Its IUPAC name is 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]sulfamoyl]ethyl carbamate.
| Compound Name | 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]sulfamoyl]ethyl carbamate |
|---|---|
| PubChem CID | 175590098 |
| Molecular Formula | C29H34ClN5O6S |
| Molecular Weight | 616.14 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]sulfamoyl]ethyl carbamate |
| SMILES | Cc1cc(OCCCc2c(C(=O)NS(=O)(=O)CCOC(N)=O)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C29H34ClN5O6S/c1-16-14-20(15-17(2)25(16)30)40-11-7-10-22-21-8-6-9-23(24-18(3)33-35(5)19(24)4)26(21)32-27(22)28(36)34-42(38,39)13-12-41-29(31)37/h6,8-9,14-15,32H,7,10-13H2,1-5H3,(H2,31,37)(H,34,36) |
| InChIKey | QEJJBYOTOWQMEY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.14 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|