C37H40ClN5O5 — CID 118394647
(2S)-2-[[2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 118394647) has the molecular formula C37H40ClN5O5 and a molecular weight of 670.21 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 118394647 |
| Molecular Formula | C37H40ClN5O5 |
| Molecular Weight | 670.21 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | (2S)-2-[[2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCC(=O)N[C@@H](Cc3ccccc3)C(=O)O)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C37H40ClN5O5/c1-21-17-26(18-22(2)33(21)38)48-16-10-15-28-27-13-9-14-29(32-23(3)42-43(5)24(32)4)34(27)41-35(28)36(45)39-20-31(44)40-30(37(46)47)19-25-11-7-6-8-12-25/h6-9,11-14,17-18,30,41H,10,15-16,19-20H2,1-5H3,(H,39,45)(H,40,44)(H,46,47)/t30-/m0/s1 |
| InChIKey | HQMNYZSQLNHIIH-PMERELPUSA-N |
| XLogP | 6.01 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.21 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|