C33H33Cl2N5O4 — CID 118395085
5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-2-methylpyridine-3-carboxylic acid (PubChem CID 118395085) has the molecular formula C33H33Cl2N5O4 and a molecular weight of 634.56 g/mol. Its IUPAC name is 5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-2-methylpyridine-3-carboxylic acid.
| Compound Name | 5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-2-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118395085 |
| Molecular Formula | C33H33Cl2N5O4 |
| Molecular Weight | 634.56 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | 5-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]-2-methylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)Nc3cnc(C)c(C(=O)O)c3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C33H33Cl2N5O4/c1-16-12-22(13-17(2)29(16)35)44-11-7-8-23-24-9-10-26(34)28(27-19(4)39-40(6)20(27)5)30(24)38-31(23)32(41)37-21-14-25(33(42)43)18(3)36-15-21/h9-10,12-15,38H,7-8,11H2,1-6H3,(H,37,41)(H,42,43) |
| InChIKey | LEPOZLXIRGHBGV-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.56 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|